C24H21IO6S2 — CID 91028088
2-[3-iodo-4-[3-(4-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 91028088) has the molecular formula C24H21IO6S2 and a molecular weight of 596.46 g/mol. Its IUPAC name is 2-[3-iodo-4-[3-(4-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[3-iodo-4-[3-(4-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 91028088 |
| Molecular Formula | C24H21IO6S2 |
| Molecular Weight | 596.46 g/mol |
| Exact Mass | 595.98 |
| IUPAC Name | 2-[3-iodo-4-[3-(4-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | CS(=O)(=O)Oc1ccc(C(=CCSc2ccc(OCC(=O)O)cc2I)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21IO6S2/c1-33(28,29)31-19-9-7-18(8-10-19)21(17-5-3-2-4-6-17)13-14-32-23-12-11-20(15-22(23)25)30-16-24(26)27/h2-13,15H,14,16H2,1H3,(H,26,27) |
| InChIKey | CQWSMTJYRFCPIF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|