C24H22O6S2 — CID 10254135
2-[4-[(E)-3-(4-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 10254135) has the molecular formula C24H22O6S2 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[4-[(E)-3-(4-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-3-(4-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 10254135 |
| Molecular Formula | C24H22O6S2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-[4-[(E)-3-(4-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | CS(=O)(=O)Oc1ccc(/C(=C/CSc2ccc(OCC(=O)O)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22O6S2/c1-32(27,28)30-21-9-7-19(8-10-21)23(18-5-3-2-4-6-18)15-16-31-22-13-11-20(12-14-22)29-17-24(25)26/h2-15H,16-17H2,1H3,(H,25,26)/b23-15+ |
| InChIKey | ZFGHYEVSAKQVKN-HZHRSRAPSA-N |
| XLogP | 4.71 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|