C24H21BrO4S — CID 68575711
2-[2-bromo-4-[3-(2-methoxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 68575711) has the molecular formula C24H21BrO4S and a molecular weight of 485.40 g/mol. Its IUPAC name is 2-[2-bromo-4-[3-(2-methoxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[3-(2-methoxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 68575711 |
| Molecular Formula | C24H21BrO4S |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 2-[2-bromo-4-[3-(2-methoxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | COc1ccccc1C(=CCSc1ccc(OCC(=O)O)c(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C24H21BrO4S/c1-28-22-10-6-5-9-20(22)19(17-7-3-2-4-8-17)13-14-30-18-11-12-23(21(25)15-18)29-16-24(26)27/h2-13,15H,14,16H2,1H3,(H,26,27) |
| InChIKey | HOZHVXMTFHXLEH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |