C24H19F3O3S — CID 10388736
2-[4-[(Z)-3-phenyl-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 10388736) has the molecular formula C24H19F3O3S and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-[4-[(Z)-3-phenyl-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-3-phenyl-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 10388736 |
| Molecular Formula | C24H19F3O3S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-[4-[(Z)-3-phenyl-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(SC/C=C(/c2ccccc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H19F3O3S/c25-24(26,27)19-8-6-18(7-9-19)22(17-4-2-1-3-5-17)14-15-31-21-12-10-20(11-13-21)30-16-23(28)29/h1-14H,15-16H2,(H,28,29)/b22-14- |
| InChIKey | UKPPOZOELPOECV-HMAPJEAMSA-N |
| XLogP | 6.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |