C25H20F3IO3S — CID 68578318
2-[2-iodo-4-[(Z)-3-phenyl-3-[4-(1,1,2-trifluoroethyl)phenyl]prop-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 68578318) has the molecular formula C25H20F3IO3S and a molecular weight of 584.40 g/mol. Its IUPAC name is 2-[2-iodo-4-[(Z)-3-phenyl-3-[4-(1,1,2-trifluoroethyl)phenyl]prop-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[2-iodo-4-[(Z)-3-phenyl-3-[4-(1,1,2-trifluoroethyl)phenyl]prop-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 68578318 |
| Molecular Formula | C25H20F3IO3S |
| Molecular Weight | 584.40 g/mol |
| Exact Mass | 584.01 |
| IUPAC Name | 2-[2-iodo-4-[(Z)-3-phenyl-3-[4-(1,1,2-trifluoroethyl)phenyl]prop-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(SC/C=C(/c2ccccc2)c2ccc(C(F)(F)CF)cc2)cc1I |
| InChI | InChI=1S/C25H20F3IO3S/c26-16-25(27,28)19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)12-13-33-20-10-11-23(22(29)14-20)32-15-24(30)31/h1-12,14H,13,15-16H2,(H,30,31)/b21-12- |
| InChIKey | FEBSVFQEACFEMD-MTJSOVHGSA-N |
| XLogP | 7.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.40 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|