C25H24O6S2 — CID 91449682
2-[3-methyl-4-[3-(3-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 91449682) has the molecular formula C25H24O6S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[3-methyl-4-[3-(3-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[3-methyl-4-[3-(3-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 91449682 |
| Molecular Formula | C25H24O6S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 2-[3-methyl-4-[3-(3-methylsulfonyloxyphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | Cc1cc(OCC(=O)O)ccc1SCC=C(c1ccccc1)c1cccc(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C25H24O6S2/c1-18-15-21(30-17-25(26)27)11-12-24(18)32-14-13-23(19-7-4-3-5-8-19)20-9-6-10-22(16-20)31-33(2,28)29/h3-13,15-16H,14,17H2,1-2H3,(H,26,27) |
| InChIKey | KZIJAEAPQHYAQR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|