C26H26O3S — CID 68574901
2-[4-[(Z)-3-(3-ethylphenyl)-3-phenylprop-2-enyl]sulfanyl-3-methylphenoxy]acetic acid (PubChem CID 68574901) has the molecular formula C26H26O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 2-[4-[(Z)-3-(3-ethylphenyl)-3-phenylprop-2-enyl]sulfanyl-3-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-3-(3-ethylphenyl)-3-phenylprop-2-enyl]sulfanyl-3-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 68574901 |
| Molecular Formula | C26H26O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-[4-[(Z)-3-(3-ethylphenyl)-3-phenylprop-2-enyl]sulfanyl-3-methylphenoxy]acetic acid |
| SMILES | CCc1cccc(/C(=C\CSc2ccc(OCC(=O)O)cc2C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H26O3S/c1-3-20-8-7-11-22(17-20)24(21-9-5-4-6-10-21)14-15-30-25-13-12-23(16-19(25)2)29-18-26(27)28/h4-14,16-17H,3,15,18H2,1-2H3,(H,27,28)/b24-14- |
| InChIKey | LGOQJXIGFNPQBE-OYKKKHCWSA-N |
| XLogP | 6.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |