C27H28N2O4 — CID 24950089
2-[4-[(E)-N-(2-carbazol-9-ylethoxy)-C-propylcarbonimidoyl]-2-methylphenoxy]acetic acid (PubChem CID 24950089) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-[4-[(E)-N-(2-carbazol-9-ylethoxy)-C-propylcarbonimidoyl]-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-N-(2-carbazol-9-ylethoxy)-C-propylcarbonimidoyl]-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 24950089 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-[4-[(E)-N-(2-carbazol-9-ylethoxy)-C-propylcarbonimidoyl]-2-methylphenoxy]acetic acid |
| SMILES | CCC/C(=N\OCCn1c2ccccc2c2ccccc21)c1ccc(OCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C27H28N2O4/c1-3-8-23(20-13-14-26(19(2)17-20)32-18-27(30)31)28-33-16-15-29-24-11-6-4-9-21(24)22-10-5-7-12-25(22)29/h4-7,9-14,17H,3,8,15-16,18H2,1-2H3,(H,30,31)/b28-23+ |
| InChIKey | WKUZTXGOIXKYIX-WEMUOSSPSA-N |
| XLogP | 5.79 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|