C25H26N2O4 — CID 173169320
2-[3-[2-[1-(4-pyridin-2-ylphenyl)butylideneamino]oxyethoxy]phenyl]acetic acid (PubChem CID 173169320) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[3-[2-[1-(4-pyridin-2-ylphenyl)butylideneamino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[1-(4-pyridin-2-ylphenyl)butylideneamino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 173169320 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[3-[2-[1-(4-pyridin-2-ylphenyl)butylideneamino]oxyethoxy]phenyl]acetic acid |
| SMILES | CCCC(=NOCCOc1cccc(CC(=O)O)c1)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-2-6-24(21-12-10-20(11-13-21)23-9-3-4-14-26-23)27-31-16-15-30-22-8-5-7-19(17-22)18-25(28)29/h3-5,7-14,17H,2,6,15-16,18H2,1H3,(H,28,29) |
| InChIKey | PWIXNUFZJBJHQT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|