C23H25N3O4 — CID 87834561
2-[3-[2-[(E)-1-(4-pyrazol-1-ylphenyl)butylideneamino]oxyethoxy]phenyl]acetic acid (PubChem CID 87834561) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[3-[2-[(E)-1-(4-pyrazol-1-ylphenyl)butylideneamino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[(E)-1-(4-pyrazol-1-ylphenyl)butylideneamino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 87834561 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[3-[2-[(E)-1-(4-pyrazol-1-ylphenyl)butylideneamino]oxyethoxy]phenyl]acetic acid |
| SMILES | CCC/C(=N\OCCOc1cccc(CC(=O)O)c1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-2-5-22(19-8-10-20(11-9-19)26-13-4-12-24-26)25-30-15-14-29-21-7-3-6-18(16-21)17-23(27)28/h3-4,6-13,16H,2,5,14-15,17H2,1H3,(H,27,28)/b25-22+ |
| InChIKey | VSQDQCGSCCGEMK-YYDJUVGSSA-N |
| XLogP | 4.10 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|