C24H26N3NaO4 — CID 87832929
sodium 2-[3-[2-[(E)-[3-methyl-1-(4-pyrazol-1-ylphenyl)butylidene]amino]oxyethoxy]phenyl]acetate (PubChem CID 87832929) has the molecular formula C24H26N3NaO4 and a molecular weight of 443.48 g/mol. Its IUPAC name is sodium 2-[3-[2-[(E)-[3-methyl-1-(4-pyrazol-1-ylphenyl)butylidene]amino]oxyethoxy]phenyl]acetate.
| Compound Name | sodium 2-[3-[2-[(E)-[3-methyl-1-(4-pyrazol-1-ylphenyl)butylidene]amino]oxyethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 87832929 |
| Molecular Formula | C24H26N3NaO4 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | sodium 2-[3-[2-[(E)-[3-methyl-1-(4-pyrazol-1-ylphenyl)butylidene]amino]oxyethoxy]phenyl]acetate |
| SMILES | CC(C)C/C(=N\OCCOc1cccc(CC(=O)[O-])c1)c1ccc(-n2cccn2)cc1.[Na+] |
| InChI | InChI=1S/C24H27N3O4.Na/c1-18(2)15-23(20-7-9-21(10-8-20)27-12-4-11-25-27)26-31-14-13-30-22-6-3-5-19(16-22)17-24(28)29;/h3-12,16,18H,13-15,17H2,1-2H3,(H,28,29);/q;+1/p-1/b26-23+; |
| InChIKey | CHGOMCDVVBNIIG-VQSOISJUSA-M |
| XLogP | 0.01 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|