C26H26NNaO4 — CID 140517190
sodium 2-[3-[3-[bis(4-methylphenyl)methylideneamino]oxypropoxy]phenyl]acetate (PubChem CID 140517190) has the molecular formula C26H26NNaO4 and a molecular weight of 439.49 g/mol. Its IUPAC name is sodium 2-[3-[3-[bis(4-methylphenyl)methylideneamino]oxypropoxy]phenyl]acetate.
| Compound Name | sodium 2-[3-[3-[bis(4-methylphenyl)methylideneamino]oxypropoxy]phenyl]acetate |
|---|---|
| PubChem CID | 140517190 |
| Molecular Formula | C26H26NNaO4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | sodium 2-[3-[3-[bis(4-methylphenyl)methylideneamino]oxypropoxy]phenyl]acetate |
| SMILES | Cc1ccc(C(=NOCCCOc2cccc(CC(=O)[O-])c2)c2ccc(C)cc2)cc1.[Na+] |
| InChI | InChI=1S/C26H27NO4.Na/c1-19-7-11-22(12-8-19)26(23-13-9-20(2)10-14-23)27-31-16-4-15-30-24-6-3-5-21(17-24)18-25(28)29;/h3,5-14,17H,4,15-16,18H2,1-2H3,(H,28,29);/q;+1/p-1 |
| InChIKey | BORJTVCEAZJMDC-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 70.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|