C28H29NO4 — CID 173169257
2-[3-[2-[[2-cyclobutyl-1-(4-phenylphenyl)ethylidene]amino]oxyethoxy]phenyl]acetic acid (PubChem CID 173169257) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 2-[3-[2-[[2-cyclobutyl-1-(4-phenylphenyl)ethylidene]amino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[[2-cyclobutyl-1-(4-phenylphenyl)ethylidene]amino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 173169257 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 2-[3-[2-[[2-cyclobutyl-1-(4-phenylphenyl)ethylidene]amino]oxyethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(OCCON=C(CC2CCC2)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H29NO4/c30-28(31)20-22-8-5-11-26(18-22)32-16-17-33-29-27(19-21-6-4-7-21)25-14-12-24(13-15-25)23-9-2-1-3-10-23/h1-3,5,8-15,18,21H,4,6-7,16-17,19-20H2,(H,30,31) |
| InChIKey | WJMFOMDBRMTCSB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|