C33H32N2O4 — CID 173144445
2-[4-[2-(2-carbazol-9-ylethoxyimino)-2-phenylethyl]-2-methylphenoxy]butanoic acid (PubChem CID 173144445) has the molecular formula C33H32N2O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is 2-[4-[2-(2-carbazol-9-ylethoxyimino)-2-phenylethyl]-2-methylphenoxy]butanoic acid.
| Compound Name | 2-[4-[2-(2-carbazol-9-ylethoxyimino)-2-phenylethyl]-2-methylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 173144445 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 2-[4-[2-(2-carbazol-9-ylethoxyimino)-2-phenylethyl]-2-methylphenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(CC(=NOCCn2c3ccccc3c3ccccc32)c2ccccc2)cc1C)C(=O)O |
| InChI | InChI=1S/C33H32N2O4/c1-3-31(33(36)37)39-32-18-17-24(21-23(32)2)22-28(25-11-5-4-6-12-25)34-38-20-19-35-29-15-9-7-13-26(29)27-14-8-10-16-30(27)35/h4-18,21,31H,3,19-20,22H2,1-2H3,(H,36,37) |
| InChIKey | KHKRVDHXPFJTJZ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|