C25H24N2O4 — CID 24949749
2-[4-[(E)-N-(2-carbazol-9-ylethoxy)-C-methylcarbonimidoyl]-2-methylphenoxy]acetic acid (PubChem CID 24949749) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[4-[(E)-N-(2-carbazol-9-ylethoxy)-C-methylcarbonimidoyl]-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-N-(2-carbazol-9-ylethoxy)-C-methylcarbonimidoyl]-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 24949749 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[4-[(E)-N-(2-carbazol-9-ylethoxy)-C-methylcarbonimidoyl]-2-methylphenoxy]acetic acid |
| SMILES | C/C(=N\OCCn1c2ccccc2c2ccccc21)c1ccc(OCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C25H24N2O4/c1-17-15-19(11-12-24(17)30-16-25(28)29)18(2)26-31-14-13-27-22-9-5-3-7-20(22)21-8-4-6-10-23(21)27/h3-12,15H,13-14,16H2,1-2H3,(H,28,29)/b26-18+ |
| InChIKey | KAKMVCUJDHBASI-NLRVBDNBSA-N |
| XLogP | 5.01 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|