C27H32N2O4S — CID 173144380
2-[2-methyl-4-[2-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxyimino]ethyl]phenoxy]butanoic acid (PubChem CID 173144380) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is 2-[2-methyl-4-[2-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxyimino]ethyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-methyl-4-[2-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxyimino]ethyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 173144380 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-[2-methyl-4-[2-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxyimino]ethyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(CC=NOCCn2c(C)ccc2-c2ccc(SC)cc2)cc1C)C(=O)O |
| InChI | InChI=1S/C27H32N2O4S/c1-5-25(27(30)31)33-26-13-7-21(18-19(26)2)14-15-28-32-17-16-29-20(3)6-12-24(29)22-8-10-23(34-4)11-9-22/h6-13,15,18,25H,5,14,16-17H2,1-4H3,(H,30,31) |
| InChIKey | RZLQVYGFPDVQIZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|