C25H24FNO4 — CID 141100568
2-[2-fluoro-3-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethoxy]phenyl]acetic acid (PubChem CID 141100568) has the molecular formula C25H24FNO4 and a molecular weight of 421.47 g/mol. Its IUPAC name is 2-[2-fluoro-3-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-3-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 141100568 |
| Molecular Formula | C25H24FNO4 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-[2-fluoro-3-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethoxy]phenyl]acetic acid |
| SMILES | CC/C(=N\OCCOc1cccc(CC(=O)O)c1F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24FNO4/c1-2-22(20-13-11-19(12-14-20)18-7-4-3-5-8-18)27-31-16-15-30-23-10-6-9-21(25(23)26)17-24(28)29/h3-14H,2,15-17H2,1H3,(H,28,29)/b27-22+ |
| InChIKey | DLVFRLMKBJOYKK-HPNDGRJYSA-N |
| XLogP | 5.33 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|