C28H30N2O4S — CID 85129731
2-[2-methyl-3-[2-[[1-(4-phenylphenyl)-2-(1,3-thiazolidin-3-yl)ethylidene]amino]oxyethoxy]phenyl]acetic acid (PubChem CID 85129731) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-[2-methyl-3-[2-[[1-(4-phenylphenyl)-2-(1,3-thiazolidin-3-yl)ethylidene]amino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-methyl-3-[2-[[1-(4-phenylphenyl)-2-(1,3-thiazolidin-3-yl)ethylidene]amino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 85129731 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[2-methyl-3-[2-[[1-(4-phenylphenyl)-2-(1,3-thiazolidin-3-yl)ethylidene]amino]oxyethoxy]phenyl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cccc1OCCON=C(CN1CCSC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N2O4S/c1-21-25(18-28(31)32)8-5-9-27(21)33-15-16-34-29-26(19-30-14-17-35-20-30)24-12-10-23(11-13-24)22-6-3-2-4-7-22/h2-13H,14-20H2,1H3,(H,31,32) |
| InChIKey | VGOCIAIXHQCVEZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|