C20H19F4NO4 — CID 173169530
2-[2-fluoro-3-[2-[1-[4-(trifluoromethyl)phenyl]propylideneamino]oxyethoxy]phenyl]acetic acid (PubChem CID 173169530) has the molecular formula C20H19F4NO4 and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-[2-fluoro-3-[2-[1-[4-(trifluoromethyl)phenyl]propylideneamino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-3-[2-[1-[4-(trifluoromethyl)phenyl]propylideneamino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 173169530 |
| Molecular Formula | C20H19F4NO4 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-[2-fluoro-3-[2-[1-[4-(trifluoromethyl)phenyl]propylideneamino]oxyethoxy]phenyl]acetic acid |
| SMILES | CCC(=NOCCOc1cccc(CC(=O)O)c1F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F4NO4/c1-2-16(13-6-8-15(9-7-13)20(22,23)24)25-29-11-10-28-17-5-3-4-14(19(17)21)12-18(26)27/h3-9H,2,10-12H2,1H3,(H,26,27) |
| InChIKey | PBKHNOJELARMJA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|