C27H29NO4 — CID 87832987
2-methyl-2-[3-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethoxy]phenyl]propanoic acid (PubChem CID 87832987) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-methyl-2-[3-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethoxy]phenyl]propanoic acid.
| Compound Name | 2-methyl-2-[3-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 87832987 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-methyl-2-[3-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethoxy]phenyl]propanoic acid |
| SMILES | CC/C(=N\OCCOc1cccc(C(C)(C)C(=O)O)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NO4/c1-4-25(22-15-13-21(14-16-22)20-9-6-5-7-10-20)28-32-18-17-31-24-12-8-11-23(19-24)27(2,3)26(29)30/h5-16,19H,4,17-18H2,1-3H3,(H,29,30)/b28-25+ |
| InChIKey | CNKAJEOTVOAHBA-AZPGRJICSA-N |
| XLogP | 5.93 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|