C26H24FNO4 — CID 173169048
2-[2-fluoro-3-[2-[(6-phenyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]oxyethoxy]phenyl]acetic acid (PubChem CID 173169048) has the molecular formula C26H24FNO4 and a molecular weight of 433.48 g/mol. Its IUPAC name is 2-[2-fluoro-3-[2-[(6-phenyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-3-[2-[(6-phenyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 173169048 |
| Molecular Formula | C26H24FNO4 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[2-fluoro-3-[2-[(6-phenyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]oxyethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(OCCON=C2CCCc3cc(-c4ccccc4)ccc32)c1F |
| InChI | InChI=1S/C26H24FNO4/c27-26-21(17-25(29)30)9-5-11-24(26)31-14-15-32-28-23-10-4-8-20-16-19(12-13-22(20)23)18-6-2-1-3-7-18/h1-3,5-7,9,11-13,16H,4,8,10,14-15,17H2,(H,29,30) |
| InChIKey | MSPVDRBDSPMQFI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|