C22H17ClF2N6 — CID 145483303
2-(2-chloro-5-fluorophenyl)-3-ethyl-8-fluoroquinoline;7H-purin-6-amine (PubChem CID 145483303) has the molecular formula C22H17ClF2N6 and a molecular weight of 438.87 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenyl)-3-ethyl-8-fluoroquinoline;7H-purin-6-amine.
| Compound Name | 2-(2-chloro-5-fluorophenyl)-3-ethyl-8-fluoroquinoline;7H-purin-6-amine |
|---|---|
| PubChem CID | 145483303 |
| Molecular Formula | C22H17ClF2N6 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-(2-chloro-5-fluorophenyl)-3-ethyl-8-fluoroquinoline;7H-purin-6-amine |
| SMILES | CCc1cc2cccc(F)c2nc1-c1cc(F)ccc1Cl.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C17H12ClF2N.C5H5N5/c1-2-10-8-11-4-3-5-15(20)17(11)21-16(10)13-9-12(19)6-7-14(13)18;6-4-3-5(9-1-7-3)10-2-8-4/h3-9H,2H2,1H3;1-2H,(H3,6,7,8,9,10) |
| InChIKey | ILEWQGUCTIINRG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |