C23H17F2N11O2 — CID 69242790
N-(2-fluoro-4-methylphenyl)-7H-purin-6-amine;N-(2-fluoro-5-nitrophenyl)-7H-purin-6-amine (PubChem CID 69242790) has the molecular formula C23H17F2N11O2 and a molecular weight of 517.46 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-7H-purin-6-amine;N-(2-fluoro-5-nitrophenyl)-7H-purin-6-amine.
| Compound Name | N-(2-fluoro-4-methylphenyl)-7H-purin-6-amine;N-(2-fluoro-5-nitrophenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 69242790 |
| Molecular Formula | C23H17F2N11O2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-7H-purin-6-amine;N-(2-fluoro-5-nitrophenyl)-7H-purin-6-amine |
| SMILES | Cc1ccc(Nc2ncnc3nc[nH]c23)c(F)c1.O=[N+]([O-])c1ccc(F)c(Nc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C12H10FN5.C11H7FN6O2/c1-7-2-3-9(8(13)4-7)18-12-10-11(15-5-14-10)16-6-17-12;12-7-2-1-6(18(19)20)3-8(7)17-11-9-10(14-4-13-9)15-5-16-11/h2-6H,1H3,(H2,14,15,16,17,18);1-5H,(H2,13,14,15,16,17) |
| InChIKey | VBFDMUIKBXPJRX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 176.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|