C11H6Br2FN5 — CID 69239287
N-(2,6-dibromo-4-fluorophenyl)-7H-purin-6-amine (PubChem CID 69239287) has the molecular formula C11H6Br2FN5 and a molecular weight of 387.01 g/mol. Its IUPAC name is N-(2,6-dibromo-4-fluorophenyl)-7H-purin-6-amine.
| Compound Name | N-(2,6-dibromo-4-fluorophenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 69239287 |
| Molecular Formula | C11H6Br2FN5 |
| Molecular Weight | 387.01 g/mol |
| Exact Mass | 384.90 |
| IUPAC Name | N-(2,6-dibromo-4-fluorophenyl)-7H-purin-6-amine |
| SMILES | Fc1cc(Br)c(Nc2ncnc3nc[nH]c23)c(Br)c1 |
| InChI | InChI=1S/C11H6Br2FN5/c12-6-1-5(14)2-7(13)8(6)19-11-9-10(16-3-15-9)17-4-18-11/h1-4H,(H2,15,16,17,18,19) |
| InChIKey | APPNVATTYZCLIA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.01 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |