C12H7F3N4 — CID 110875231
N-(2,3,4-trifluorophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 110875231) has the molecular formula C12H7F3N4 and a molecular weight of 264.21 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,3,4-trifluorophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110875231 |
| Molecular Formula | C12H7F3N4 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Fc1ccc(Nc2ncnc3[nH]ccc23)c(F)c1F |
| InChI | InChI=1S/C12H7F3N4/c13-7-1-2-8(10(15)9(7)14)19-12-6-3-4-16-11(6)17-5-18-12/h1-5H,(H2,16,17,18,19) |
| InChIKey | PZIYVXAGKUNKNT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|