About N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 166464576) has the molecular formula C18H12Cl2N4O
and a molecular weight of 371.23 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 166464576 |
| Molecular Formula | C18H12Cl2N4O |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1ccc(Oc2ccc(Nc3ncnc4[nH]ccc34)cc2)c(Cl)c1 |
| InChI | InChI=1S/C18H12Cl2N4O/c19-11-1-6-16(15(20)9-11)25-13-4-2-12(3-5-13)24-18-14-7-8-21-17(14)22-10-23-18/h1-10H,(H2,21,22,23,24) |
| InChIKey | PEJDSGDBWVOOSF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CID 166464576) is N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is Clc1ccc(Oc2ccc(Nc3ncnc4[nH]ccc34)cc2)c(Cl)c1.
What is the InChIKey of N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is PEJDSGDBWVOOSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2N4O/c19-11-1-6-16(15(20)9-11)25-13-4-2-12(3-5-13)24-18-14-7-8-21-17(14)22-10-23-18/h1-10H,(H2,21,22,23,24).
What are the key properties of N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 371.23 g/mol, XLogP of 5.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,4-dichlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 166464576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).