C21H16N6S — CID 108779625
N-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]phenyl]-7H-purin-6-amine (PubChem CID 108779625) has the molecular formula C21H16N6S and a molecular weight of 384.47 g/mol. Its IUPAC name is N-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]phenyl]-7H-purin-6-amine.
| Compound Name | N-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]phenyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 108779625 |
| Molecular Formula | C21H16N6S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[4-[2-(2-methylphenyl)-1,3-thiazol-4-yl]phenyl]-7H-purin-6-amine |
| SMILES | Cc1ccccc1-c1nc(-c2ccc(Nc3ncnc4nc[nH]c34)cc2)cs1 |
| InChI | InChI=1S/C21H16N6S/c1-13-4-2-3-5-16(13)21-27-17(10-28-21)14-6-8-15(9-7-14)26-20-18-19(23-11-22-18)24-12-25-20/h2-12H,1H3,(H2,22,23,24,25,26) |
| InChIKey | KRAUAQSUBPOTJS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |