C12H8N6S2 — CID 108777079
N-(7H-purin-6-yl)-4-thiophen-2-yl-1,3-thiazol-2-amine (PubChem CID 108777079) has the molecular formula C12H8N6S2 and a molecular weight of 300.37 g/mol. Its IUPAC name is N-(7H-purin-6-yl)-4-thiophen-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-(7H-purin-6-yl)-4-thiophen-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 108777079 |
| Molecular Formula | C12H8N6S2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-(7H-purin-6-yl)-4-thiophen-2-yl-1,3-thiazol-2-amine |
| SMILES | c1csc(-c2csc(Nc3ncnc4nc[nH]c34)n2)c1 |
| InChI | InChI=1S/C12H8N6S2/c1-2-8(19-3-1)7-4-20-12(17-7)18-11-9-10(14-5-13-9)15-6-16-11/h1-6H,(H2,13,14,15,16,17,18) |
| InChIKey | VVZGXTZEUZXQKR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |