C18H17N7O — CID 130321821
4-methoxy-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine (PubChem CID 130321821) has the molecular formula C18H17N7O and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-methoxy-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine.
| Compound Name | 4-methoxy-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 130321821 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-methoxy-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine |
| SMILES | CNc1ccc(OC)c(Nc2ncccc2-c2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C18H17N7O/c1-19-11-5-6-14(26-2)13(8-11)25-17-12(4-3-7-20-17)15-16-18(23-9-21-15)24-10-22-16/h3-10,19H,1-2H3,(H,20,25)(H,21,22,23,24) |
| InChIKey | YSVVPYKETHMTGV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|