C25H28N8O — CID 164905649
2-(azepan-1-yl)-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]acetamide (PubChem CID 164905649) has the molecular formula C25H28N8O and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]acetamide.
| Compound Name | 2-(azepan-1-yl)-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 164905649 |
| Molecular Formula | C25H28N8O |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-(azepan-1-yl)-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCCCCC2)cc1Nc1ncccc1-c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C25H28N8O/c1-17-8-9-18(31-21(34)14-33-11-4-2-3-5-12-33)13-20(17)32-24-19(7-6-10-26-24)22-23-25(29-15-27-22)30-16-28-23/h6-10,13,15-16H,2-5,11-12,14H2,1H3,(H,26,32)(H,31,34)(H,27,28,29,30) |
| InChIKey | HAHQQQXPHSSNGQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |