C23H14F3N7O — CID 139548472
3,5-difluoro-N-[2-fluoro-5-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide (PubChem CID 139548472) has the molecular formula C23H14F3N7O and a molecular weight of 461.41 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-fluoro-5-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide.
| Compound Name | 3,5-difluoro-N-[2-fluoro-5-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 139548472 |
| Molecular Formula | C23H14F3N7O |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 3,5-difluoro-N-[2-fluoro-5-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide |
| SMILES | O=C(Nc1cc(Nc2ncccc2-c2ncnc3nc[nH]c23)ccc1F)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H14F3N7O/c24-13-6-12(7-14(25)8-13)23(34)33-18-9-15(3-4-17(18)26)32-21-16(2-1-5-27-21)19-20-22(30-10-28-19)31-11-29-20/h1-11H,(H,27,32)(H,33,34)(H,28,29,30,31) |
| InChIKey | MMJAXQKJOGXVDU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |