C25H20ClN7O — CID 118720458
4-chloro-3-methyl-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide (PubChem CID 118720458) has the molecular formula C25H20ClN7O and a molecular weight of 469.94 g/mol. Its IUPAC name is 4-chloro-3-methyl-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide.
| Compound Name | 4-chloro-3-methyl-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 118720458 |
| Molecular Formula | C25H20ClN7O |
| Molecular Weight | 469.94 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-chloro-3-methyl-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C)c(Nc3ncccc3-c3ncnc4nc[nH]c34)c2)ccc1Cl |
| InChI | InChI=1S/C25H20ClN7O/c1-14-5-7-17(32-25(34)16-6-8-19(26)15(2)10-16)11-20(14)33-23-18(4-3-9-27-23)21-22-24(30-12-28-21)31-13-29-22/h3-13H,1-2H3,(H,27,33)(H,32,34)(H,28,29,30,31) |
| InChIKey | GHLGXWRGXAEXSW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.94 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |