C26H22ClN7O — CID 73331186
4-chloro-N-(3-propan-2-ylphenyl)-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]benzamide (PubChem CID 73331186) has the molecular formula C26H22ClN7O and a molecular weight of 483.96 g/mol. Its IUPAC name is 4-chloro-N-(3-propan-2-ylphenyl)-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]benzamide.
| Compound Name | 4-chloro-N-(3-propan-2-ylphenyl)-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]benzamide |
|---|---|
| PubChem CID | 73331186 |
| Molecular Formula | C26H22ClN7O |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 4-chloro-N-(3-propan-2-ylphenyl)-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]benzamide |
| SMILES | CC(C)c1cccc(NC(=O)c2ccc(Cl)c(Nc3ncccc3-c3ncnc4nc[nH]c34)c2)c1 |
| InChI | InChI=1S/C26H22ClN7O/c1-15(2)16-5-3-6-18(11-16)33-26(35)17-8-9-20(27)21(12-17)34-24-19(7-4-10-28-24)22-23-25(31-13-29-22)32-14-30-23/h3-15H,1-2H3,(H,28,34)(H,33,35)(H,29,30,31,32) |
| InChIKey | VINDXEHBECAULT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |