C25H20FN7O3 — CID 130321813
N-[2-fluoro-5-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]-3,5-dimethoxybenzamide (PubChem CID 130321813) has the molecular formula C25H20FN7O3 and a molecular weight of 485.48 g/mol. Its IUPAC name is N-[2-fluoro-5-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-fluoro-5-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 130321813 |
| Molecular Formula | C25H20FN7O3 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[2-fluoro-5-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2cc(Nc3ncccc3-c3ncnc4nc[nH]c34)ccc2F)c1 |
| InChI | InChI=1S/C25H20FN7O3/c1-35-16-8-14(9-17(11-16)36-2)25(34)33-20-10-15(5-6-19(20)26)32-23-18(4-3-7-27-23)21-22-24(30-12-28-21)31-13-29-22/h3-13H,1-2H3,(H,27,32)(H,33,34)(H,28,29,30,31) |
| InChIKey | NNEOFRVOSGKSEP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |