C26H24N8O — CID 73331320
3-(dimethylamino)-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide (PubChem CID 73331320) has the molecular formula C26H24N8O and a molecular weight of 464.53 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 73331320 |
| Molecular Formula | C26H24N8O |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3-(dimethylamino)-N-[4-methyl-3-[[3-(7H-purin-6-yl)-2-pyridinyl]amino]phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(N(C)C)c2)cc1Nc1ncccc1-c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C26H24N8O/c1-16-9-10-18(32-26(35)17-6-4-7-19(12-17)34(2)3)13-21(16)33-24-20(8-5-11-27-24)22-23-25(30-14-28-22)31-15-29-23/h4-15H,1-3H3,(H,27,33)(H,32,35)(H,28,29,30,31) |
| InChIKey | UHZCQUJTKLRWKF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |