C27H32F2IN8OP — CID 164905814
2-(3,3-difluoroazepan-1-yl)-N-[3-[[3-(9-iodophosphanylpurin-6-yl)-2-pyridinyl]amino]-4-methylphenyl]acetamide;ethane (PubChem CID 164905814) has the molecular formula C27H32F2IN8OP and a molecular weight of 680.48 g/mol. Its IUPAC name is 2-(3,3-difluoroazepan-1-yl)-N-[3-[[3-(9-iodophosphanylpurin-6-yl)-2-pyridinyl]amino]-4-methylphenyl]acetamide;ethane.
| Compound Name | 2-(3,3-difluoroazepan-1-yl)-N-[3-[[3-(9-iodophosphanylpurin-6-yl)-2-pyridinyl]amino]-4-methylphenyl]acetamide;ethane |
|---|---|
| PubChem CID | 164905814 |
| Molecular Formula | C27H32F2IN8OP |
| Molecular Weight | 680.48 g/mol |
| Exact Mass | 680.14 |
| IUPAC Name | 2-(3,3-difluoroazepan-1-yl)-N-[3-[[3-(9-iodophosphanylpurin-6-yl)-2-pyridinyl]amino]-4-methylphenyl]acetamide;ethane |
| SMILES | CC.Cc1ccc(NC(=O)CN2CCCCC(F)(F)C2)cc1Nc1ncccc1-c1ncnc2c1ncn2PI |
| InChI | InChI=1S/C25H26F2IN8OP.C2H6/c1-16-6-7-17(33-20(37)12-35-10-3-2-8-25(26,27)13-35)11-19(16)34-23-18(5-4-9-29-23)21-22-24(31-14-30-21)36(38-28)15-32-22;1-2/h4-7,9,11,14-15,38H,2-3,8,10,12-13H2,1H3,(H,29,34)(H,33,37);1-2H3 |
| InChIKey | YAVFGBNOVHUFOB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|