C29H31N7O2 — CID 145384028
3-tert-butylbenzaldehyde;4-methoxy-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine (PubChem CID 145384028) has the molecular formula C29H31N7O2 and a molecular weight of 509.61 g/mol. Its IUPAC name is 3-tert-butylbenzaldehyde;4-methoxy-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine.
| Compound Name | 3-tert-butylbenzaldehyde;4-methoxy-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 145384028 |
| Molecular Formula | C29H31N7O2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 3-tert-butylbenzaldehyde;4-methoxy-1-N-methyl-3-N-[3-(7H-purin-6-yl)-2-pyridinyl]benzene-1,3-diamine |
| SMILES | CC(C)(C)c1cccc(C=O)c1.CNc1ccc(OC)c(Nc2ncccc2-c2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C18H17N7O.C11H14O/c1-19-11-5-6-14(26-2)13(8-11)25-17-12(4-3-7-20-17)15-16-18(23-9-21-15)24-10-22-16;1-11(2,3)10-6-4-5-9(7-10)8-12/h3-10,19H,1-2H3,(H,20,25)(H,21,22,23,24);4-8H,1-3H3 |
| InChIKey | LOGFGCWLLNWNDN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|