C16H20N2O2 — CID 171697744
N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-5-methylpyridin-2-amine (PubChem CID 171697744) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-5-methylpyridin-2-amine.
| Compound Name | N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 171697744 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-5-methylpyridin-2-amine |
| SMILES | COc1ccc([C@@H](C)Nc2ccc(C)cn2)cc1OC |
| InChI | InChI=1S/C16H20N2O2/c1-11-5-8-16(17-10-11)18-12(2)13-6-7-14(19-3)15(9-13)20-4/h5-10,12H,1-4H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | LDMZINRQTUQLSC-GFCCVEGCSA-N |
| XLogP | 3.58 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |