C15H22F3NS — CID 106426895
1-(4-tert-butylphenyl)-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine (PubChem CID 106426895) has the molecular formula C15H22F3NS and a molecular weight of 305.41 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine.
| Compound Name | 1-(4-tert-butylphenyl)-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 106426895 |
| Molecular Formula | C15H22F3NS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(4-tert-butylphenyl)-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine |
| SMILES | CC(NCCSC(F)(F)F)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22F3NS/c1-11(19-9-10-20-15(16,17)18)12-5-7-13(8-6-12)14(2,3)4/h5-8,11,19H,9-10H2,1-4H3 |
| InChIKey | PQOCSJCYTBTBKH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|