C14H20F3NS — CID 106426996
N-[2-(trifluoromethylsulfanyl)ethyl]-1-(2,4,5-trimethylphenyl)ethanamine (PubChem CID 106426996) has the molecular formula C14H20F3NS and a molecular weight of 291.38 g/mol. Its IUPAC name is N-[2-(trifluoromethylsulfanyl)ethyl]-1-(2,4,5-trimethylphenyl)ethanamine.
| Compound Name | N-[2-(trifluoromethylsulfanyl)ethyl]-1-(2,4,5-trimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 106426996 |
| Molecular Formula | C14H20F3NS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-[2-(trifluoromethylsulfanyl)ethyl]-1-(2,4,5-trimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(C(C)NCCSC(F)(F)F)cc1C |
| InChI | InChI=1S/C14H20F3NS/c1-9-7-11(3)13(8-10(9)2)12(4)18-5-6-19-14(15,16)17/h7-8,12,18H,5-6H2,1-4H3 |
| InChIKey | DVOCIHAQLFTPDP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|