C15H19F2N3O — CID 115708669
N-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-pyrazol-1-ylpropan-1-amine (PubChem CID 115708669) has the molecular formula C15H19F2N3O and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-pyrazol-1-ylpropan-1-amine.
| Compound Name | N-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-pyrazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 115708669 |
| Molecular Formula | C15H19F2N3O |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-pyrazol-1-ylpropan-1-amine |
| SMILES | CC(NCCCn1cccn1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H19F2N3O/c1-12(18-8-2-10-20-11-3-9-19-20)13-4-6-14(7-5-13)21-15(16)17/h3-7,9,11-12,15,18H,2,8,10H2,1H3 |
| InChIKey | NZJROBZLFSEGIE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|