C20H15BrN4O4S — CID 4994706
N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-5-bromofuran-2-carboxamide (PubChem CID 4994706) has the molecular formula C20H15BrN4O4S and a molecular weight of 487.34 g/mol. Its IUPAC name is N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 4994706 |
| Molecular Formula | C20H15BrN4O4S |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-5-bromofuran-2-carboxamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccc(Br)o1)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15BrN4O4S/c21-16-11-10-15(29-16)19(28)23-20(30)25-24-18(27)13-6-8-14(9-7-13)22-17(26)12-4-2-1-3-5-12/h1-11H,(H,22,26)(H,24,27)(H2,23,25,28,30) |
| InChIKey | ATIDARZZVHSHHB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|