C19H12BrClFN3O3S — CID 26167273
5-bromo-N-[[3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 26167273) has the molecular formula C19H12BrClFN3O3S and a molecular weight of 496.75 g/mol. Its IUPAC name is 5-bromo-N-[[3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[[3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26167273 |
| Molecular Formula | C19H12BrClFN3O3S |
| Molecular Weight | 496.75 g/mol |
| Exact Mass | 494.95 |
| IUPAC Name | 5-bromo-N-[[3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1cccc(NC(=S)NC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C19H12BrClFN3O3S/c20-16-7-6-15(28-16)18(27)25-19(29)24-11-3-1-2-10(8-11)17(26)23-12-4-5-14(22)13(21)9-12/h1-9H,(H,23,26)(H2,24,25,27,29) |
| InChIKey | SABMJXZUQJQCKX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|