C23H18Cl2FN3O2S — CID 26167391
N-(3-chloro-4-fluorophenyl)-3-[3-(2-chlorophenyl)propanoylcarbamothioylamino]benzamide (PubChem CID 26167391) has the molecular formula C23H18Cl2FN3O2S and a molecular weight of 490.39 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[3-(2-chlorophenyl)propanoylcarbamothioylamino]benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[3-(2-chlorophenyl)propanoylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 26167391 |
| Molecular Formula | C23H18Cl2FN3O2S |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[3-(2-chlorophenyl)propanoylcarbamothioylamino]benzamide |
| SMILES | O=C(CCc1ccccc1Cl)NC(=S)Nc1cccc(C(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H18Cl2FN3O2S/c24-18-7-2-1-4-14(18)8-11-21(30)29-23(32)28-16-6-3-5-15(12-16)22(31)27-17-9-10-20(26)19(25)13-17/h1-7,9-10,12-13H,8,11H2,(H,27,31)(H2,28,29,30,32) |
| InChIKey | KXQCVUNTTSKGFD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|