C22H22BrNO3 — CID 2435744
5-bromo-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]furan-2-carboxamide (PubChem CID 2435744) has the molecular formula C22H22BrNO3 and a molecular weight of 428.33 g/mol. Its IUPAC name is 5-bromo-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2435744 |
| Molecular Formula | C22H22BrNO3 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 5-bromo-N-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]furan-2-carboxamide |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NC(=O)c3ccc(Br)o3)cc2)cc1 |
| InChI | InChI=1S/C22H22BrNO3/c1-4-22(2,3)15-5-9-17(10-6-15)26-18-11-7-16(8-12-18)24-21(25)19-13-14-20(23)27-19/h5-14H,4H2,1-3H3,(H,24,25) |
| InChIKey | JNFUKCRLKSYKNO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |