C24H19BrN2O4 — CID 108928135
[3-[[2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108928135) has the molecular formula C24H19BrN2O4 and a molecular weight of 479.33 g/mol. Its IUPAC name is [3-[[2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928135 |
| Molecular Formula | C24H19BrN2O4 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | [3-[[2-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccccc2NC(=O)/C=C/c2ccccc2Br)c1 |
| InChI | InChI=1S/C24H19BrN2O4/c1-16(28)31-19-9-6-8-18(15-19)24(30)27-22-12-5-4-11-21(22)26-23(29)14-13-17-7-2-3-10-20(17)25/h2-15H,1H3,(H,26,29)(H,27,30)/b14-13+ |
| InChIKey | WYPNUYCTNFQNFD-BUHFOSPRSA-N |
| XLogP | 5.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|