C25H21BrN2O4 — CID 108929266
[3-[[3-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]phenyl]methylcarbamoyl]phenyl] acetate (PubChem CID 108929266) has the molecular formula C25H21BrN2O4 and a molecular weight of 493.36 g/mol. Its IUPAC name is [3-[[3-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]phenyl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[3-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108929266 |
| Molecular Formula | C25H21BrN2O4 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | [3-[[3-[[(E)-3-(2-bromophenyl)prop-2-enoyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCc2cccc(NC(=O)/C=C/c3ccccc3Br)c2)c1 |
| InChI | InChI=1S/C25H21BrN2O4/c1-17(29)32-22-10-5-8-20(15-22)25(31)27-16-18-6-4-9-21(14-18)28-24(30)13-12-19-7-2-3-11-23(19)26/h2-15H,16H2,1H3,(H,27,31)(H,28,30)/b13-12+ |
| InChIKey | WGNBJWLUWGURGH-OUKQBFOZSA-N |
| XLogP | 4.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|