C20H20F2N2O5 — CID 9320640
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N'-[2-(2-methylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 9320640) has the molecular formula C20H20F2N2O5 and a molecular weight of 406.39 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N'-[2-(2-methylphenoxy)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N'-[2-(2-methylphenoxy)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9320640 |
| Molecular Formula | C20H20F2N2O5 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N'-[2-(2-methylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | COc1cccc(/C=C/C(=O)NNC(=O)COc2ccccc2C)c1OC(F)F |
| InChI | InChI=1S/C20H20F2N2O5/c1-13-6-3-4-8-15(13)28-12-18(26)24-23-17(25)11-10-14-7-5-9-16(27-2)19(14)29-20(21)22/h3-11,20H,12H2,1-2H3,(H,23,25)(H,24,26)/b11-10+ |
| InChIKey | UFLGGRISNYYDCM-ZHACJKMWSA-N |
| XLogP | 2.84 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|