C17H16BrF2NO4 — CID 122157326
6-bromo-N-[[2-(difluoromethoxy)-3-methoxyphenyl]methyl]-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 122157326) has the molecular formula C17H16BrF2NO4 and a molecular weight of 416.22 g/mol. Its IUPAC name is 6-bromo-N-[[2-(difluoromethoxy)-3-methoxyphenyl]methyl]-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-bromo-N-[[2-(difluoromethoxy)-3-methoxyphenyl]methyl]-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 122157326 |
| Molecular Formula | C17H16BrF2NO4 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 6-bromo-N-[[2-(difluoromethoxy)-3-methoxyphenyl]methyl]-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | COc1cccc(CNc2cc3c(cc2Br)OCCO3)c1OC(F)F |
| InChI | InChI=1S/C17H16BrF2NO4/c1-22-13-4-2-3-10(16(13)25-17(19)20)9-21-12-8-15-14(7-11(12)18)23-5-6-24-15/h2-4,7-8,17,21H,5-6,9H2,1H3 |
| InChIKey | PQEVUACQJWPDEN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|