C15H14BrF2NO2 — CID 107609950
4-bromo-N-[(2,3-dimethoxyphenyl)methyl]-2,5-difluoroaniline (PubChem CID 107609950) has the molecular formula C15H14BrF2NO2 and a molecular weight of 358.18 g/mol. Its IUPAC name is 4-bromo-N-[(2,3-dimethoxyphenyl)methyl]-2,5-difluoroaniline.
| Compound Name | 4-bromo-N-[(2,3-dimethoxyphenyl)methyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107609950 |
| Molecular Formula | C15H14BrF2NO2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 4-bromo-N-[(2,3-dimethoxyphenyl)methyl]-2,5-difluoroaniline |
| SMILES | COc1cccc(CNc2cc(F)c(Br)cc2F)c1OC |
| InChI | InChI=1S/C15H14BrF2NO2/c1-20-14-5-3-4-9(15(14)21-2)8-19-13-7-11(17)10(16)6-12(13)18/h3-7,19H,8H2,1-2H3 |
| InChIKey | PWPZVWNHOWBKEB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|